C19H19BrN2O4S — CID 30759506
6-bromo-N-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]-2H-chromene-3-carboxamide (PubChem CID 30759506) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is 6-bromo-N-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-bromo-N-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 30759506 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 6-bromo-N-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]-2H-chromene-3-carboxamide |
| SMILES | C[C@@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-12(13-3-6-17(7-4-13)27(21,24)25)22(2)19(23)15-9-14-10-16(20)5-8-18(14)26-11-15/h3-10,12H,11H2,1-2H3,(H2,21,24,25)/t12-/m0/s1 |
| InChIKey | YFRQMFFFNOQDNN-LBPRGKRZSA-N |
| XLogP | 3.09 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |