C21H23N3O3S — CID 24612098
N,4-dimethyl-3-pyrrol-1-yl-N-[1-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 24612098) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N,4-dimethyl-3-pyrrol-1-yl-N-[1-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | N,4-dimethyl-3-pyrrol-1-yl-N-[1-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24612098 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N,4-dimethyl-3-pyrrol-1-yl-N-[1-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(C)C(C)c2ccc(S(N)(=O)=O)cc2)cc1-n1cccc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-15-6-7-18(14-20(15)24-12-4-5-13-24)21(25)23(3)16(2)17-8-10-19(11-9-17)28(22,26)27/h4-14,16H,1-3H3,(H2,22,26,27) |
| InChIKey | VGSPFZODHQYHLG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |