C15H19N3O4S — CID 99804013
3-(furan-2-ylmethyl)-1-methyl-1-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea (PubChem CID 99804013) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1-methyl-1-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea.
| Compound Name | 3-(furan-2-ylmethyl)-1-methyl-1-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 99804013 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1-methyl-1-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea |
| SMILES | C[C@H](c1cccc(S(N)(=O)=O)c1)N(C)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H19N3O4S/c1-11(12-5-3-7-14(9-12)23(16,20)21)18(2)15(19)17-10-13-6-4-8-22-13/h3-9,11H,10H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-/m1/s1 |
| InChIKey | ICNQVJSVCZCBRL-LLVKDONJSA-N |
| XLogP | 1.83 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |