C17H22N2O4S — CID 95594368
N-(furan-2-ylmethyl)-2-[methyl-[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]acetamide (PubChem CID 95594368) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[methyl-[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[methyl-[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 95594368 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[methyl-[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]acetamide |
| SMILES | C[C@H](c1ccc(S(C)(=O)=O)cc1)N(C)CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H22N2O4S/c1-13(14-6-8-16(9-7-14)24(3,21)22)19(2)12-17(20)18-11-15-5-4-10-23-15/h4-10,13H,11-12H2,1-3H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | JOMXYVLRSBVHBX-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |