C17H22N2O4S — CID 18170892
N-(furan-2-ylmethyl)-2-[methyl-(4-propylphenyl)sulfonylamino]acetamide (PubChem CID 18170892) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[methyl-(4-propylphenyl)sulfonylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[methyl-(4-propylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 18170892 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[methyl-(4-propylphenyl)sulfonylamino]acetamide |
| SMILES | CCCc1ccc(S(=O)(=O)N(C)CC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-3-5-14-7-9-16(10-8-14)24(21,22)19(2)13-17(20)18-12-15-6-4-11-23-15/h4,6-11H,3,5,12-13H2,1-2H3,(H,18,20) |
| InChIKey | KOZDZAXCRUHKRL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |