C17H21N5O4S — CID 46330284
N-(furan-2-ylmethyl)-2-[methyl-(1-propan-2-ylbenzotriazol-5-yl)sulfonylamino]acetamide (PubChem CID 46330284) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[methyl-(1-propan-2-ylbenzotriazol-5-yl)sulfonylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[methyl-(1-propan-2-ylbenzotriazol-5-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 46330284 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[methyl-(1-propan-2-ylbenzotriazol-5-yl)sulfonylamino]acetamide |
| SMILES | CC(C)n1nnc2cc(S(=O)(=O)N(C)CC(=O)NCc3ccco3)ccc21 |
| InChI | InChI=1S/C17H21N5O4S/c1-12(2)22-16-7-6-14(9-15(16)19-20-22)27(24,25)21(3)11-17(23)18-10-13-5-4-8-26-13/h4-9,12H,10-11H2,1-3H3,(H,18,23) |
| InChIKey | YUTOZPARANMXHZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |