C25H29N3O6S — CID 55516644
methyl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzoate (PubChem CID 55516644) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzoate.
| Compound Name | methyl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 55516644 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | methyl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzoate |
| SMILES | COC(=O)c1ccc(N2CCCC2)c(NC(=O)/C=C/c2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C25H29N3O6S/c1-33-25(30)20-7-10-23(27-12-2-3-13-27)22(18-20)26-24(29)11-6-19-4-8-21(9-5-19)35(31,32)28-14-16-34-17-15-28/h4-11,18H,2-3,12-17H2,1H3,(H,26,29)/b11-6+ |
| InChIKey | JCLDXLVDAHFIGQ-IZZDOVSWSA-N |
| XLogP | 2.75 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|