C21H18Cl2N2OS — CID 6079591
(E)-3-(2,4-dichlorophenyl)-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 6079591) has the molecular formula C21H18Cl2N2OS and a molecular weight of 417.36 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6079591 |
| Molecular Formula | C21H18Cl2N2OS |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)/C=C/c3ccc(Cl)cc3Cl)n2)cc1 |
| InChI | InChI=1S/C21H18Cl2N2OS/c1-13(2)14-3-5-16(6-4-14)19-12-27-21(24-19)25-20(26)10-8-15-7-9-17(22)11-18(15)23/h3-13H,1-2H3,(H,24,25,26)/b10-8+ |
| InChIKey | FCQSMHVFAGYHCL-CSKARUKUSA-N |
| XLogP | 6.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|