C25H28N2OS — CID 6369891
(E)-N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 6369891) has the molecular formula C25H28N2OS and a molecular weight of 404.58 g/mol. Its IUPAC name is (E)-N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6369891 |
| Molecular Formula | C25H28N2OS |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (E)-N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCC(C)c1ccc(-c2csc(NC(=O)/C=C/c3ccc(C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C25H28N2OS/c1-5-18(4)21-11-13-22(14-12-21)23-16-29-25(26-23)27-24(28)15-8-19-6-9-20(10-7-19)17(2)3/h6-18H,5H2,1-4H3,(H,26,27,28)/b15-8+ |
| InChIKey | UBZUICZQMBRJKW-OVCLIPMQSA-N |
| XLogP | 7.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|