C17H22N2O4 — CID 7952589
cis-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate (PubChem CID 7952589) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is cis-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7952589 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | cis-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
| SMILES | C[C@H]1C[C@H]1C(=O)OCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-12-10-15(12)17(21)23-11-16(20)18-13-2-4-14(5-3-13)19-6-8-22-9-7-19/h2-5,12,15H,6-11H2,1H3,(H,18,20)/t12-,15+/m0/s1 |
| InChIKey | CXGADZDRUOATJV-SWLSCSKDSA-N |
| XLogP | 1.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|