C21H17NO5S — CID 8516451
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 8516451) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8516451 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | COc1ccc2cc(/C=C/C(=O)OCC(=O)NC(=O)c3cccs3)ccc2c1 |
| InChI | InChI=1S/C21H17NO5S/c1-26-17-8-7-15-11-14(4-6-16(15)12-17)5-9-20(24)27-13-19(23)22-21(25)18-3-2-10-28-18/h2-12H,13H2,1H3,(H,22,23,25)/b9-5+ |
| InChIKey | HPGOZNNGBMZDPM-WEVVVXLNSA-N |
| XLogP | 3.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|