C19H22Cl2N4O4 — CID 46694122
3-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]oxypropyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 46694122) has the molecular formula C19H22Cl2N4O4 and a molecular weight of 441.32 g/mol. Its IUPAC name is 3-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]oxypropyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | 3-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]oxypropyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46694122 |
| Molecular Formula | C19H22Cl2N4O4 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]oxypropyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)OCCCOC(=O)/C=C/c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C19H22Cl2N4O4/c1-12-14(18(20)24(3)22-12)6-8-16(26)28-10-5-11-29-17(27)9-7-15-13(2)23-25(4)19(15)21/h6-9H,5,10-11H2,1-4H3/b8-6+,9-7+ |
| InChIKey | KBDADSJXYZCWMR-CDJQDVQCSA-N |
| XLogP | 3.28 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|