C18H15Cl2N3O2S — CID 46562392
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 46562392) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46562392 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)OCc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H15Cl2N3O2S/c1-11-15(17(20)23(2)22-11)7-8-16(24)25-9-14-10-26-18(21-14)12-3-5-13(19)6-4-12/h3-8,10H,9H2,1-2H3/b8-7+ |
| InChIKey | QAQUXIPTKBZJSR-BQYQJAHWSA-N |
| XLogP | 4.92 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|