C17H19FN2O3 — CID 7792679
(3-fluoro-4-methoxyphenyl)methyl (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 7792679) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7792679 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | COc1ccc(COC(=O)/C=C/c2c(C)nn(C)c2C)cc1F |
| InChI | InChI=1S/C17H19FN2O3/c1-11-14(12(2)20(3)19-11)6-8-17(21)23-10-13-5-7-16(22-4)15(18)9-13/h5-9H,10H2,1-4H3/b8-6+ |
| InChIKey | YKVAESFIALVBBG-SOFGYWHQSA-N |
| XLogP | 2.94 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|