C25H29N3O3 — CID 32912882
(E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 32912882) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 32912882 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methyl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | COc1cc(CN(C)C(=O)/C=C/c2c(C)nn(C)c2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O3/c1-18-22(19(2)28(4)26-18)12-14-25(29)27(3)16-21-11-13-23(24(15-21)30-5)31-17-20-9-7-6-8-10-20/h6-15H,16-17H2,1-5H3/b14-12+ |
| InChIKey | HPQMGEDMHOIDQY-WYMLVPIESA-N |
| XLogP | 4.30 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|