C20H31ClN4O — CID 55591618
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 55591618) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55591618 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N2CCN(C3CCCC3)CC2)c1Cl |
| InChI | InChI=1S/C20H31ClN4O/c1-3-4-11-25-20(21)18(16(2)22-25)9-10-19(26)24-14-12-23(13-15-24)17-7-5-6-8-17/h9-10,17H,3-8,11-15H2,1-2H3/b10-9+ |
| InChIKey | WHRJPWGOZJJKIB-MDZDMXLPSA-N |
| XLogP | 3.75 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|