C22H22ClFN4O3S — CID 78846164
3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide (PubChem CID 78846164) has the molecular formula C22H22ClFN4O3S and a molecular weight of 476.96 g/mol. Its IUPAC name is 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide.
| Compound Name | 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78846164 |
| Molecular Formula | C22H22ClFN4O3S |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)C=Cc2c(C)nn(-c3ccc(F)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C22H22ClFN4O3S/c1-15-3-9-19(10-4-15)32(30,31)26-14-13-25-21(29)12-11-20-16(2)27-28(22(20)23)18-7-5-17(24)6-8-18/h3-12,26H,13-14H2,1-2H3,(H,25,29) |
| InChIKey | KMBSDISMDAJBQS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|