C17H11Cl2FN2OS — CID 7946950
(E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(5-chlorothiophen-2-yl)prop-2-en-1-one (PubChem CID 7946950) has the molecular formula C17H11Cl2FN2OS and a molecular weight of 381.26 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(5-chlorothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(5-chlorothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7946950 |
| Molecular Formula | C17H11Cl2FN2OS |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(5-chlorothiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=C/C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H11Cl2FN2OS/c1-10-13(6-7-14(23)15-8-9-16(18)24-15)17(19)22(21-10)12-4-2-11(20)3-5-12/h2-9H,1H3/b7-6+ |
| InChIKey | COVMZOYWOJUQPA-VOTSOKGWSA-N |
| XLogP | 5.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|