C19H26N4O2 — CID 75533647
(E)-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-3-(4-propoxyphenyl)prop-2-enamide (PubChem CID 75533647) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (E)-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-3-(4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-3-(4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75533647 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (E)-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-3-(4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NCCn2cnnc2C(C)C)cc1 |
| InChI | InChI=1S/C19H26N4O2/c1-4-13-25-17-8-5-16(6-9-17)7-10-18(24)20-11-12-23-14-21-22-19(23)15(2)3/h5-10,14-15H,4,11-13H2,1-3H3,(H,20,24)/b10-7+ |
| InChIKey | TZOBOUKXRSDEDO-JXMROGBWSA-N |
| XLogP | 3.02 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|