C23H22N4O5 — CID 121033744
(E)-N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 121033744) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is (E)-N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121033744 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (E)-N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1ccc(-c2ccc(=O)n(CCNC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C23H22N4O5/c1-2-32-20-10-6-18(7-11-20)21-12-14-23(29)26(25-21)16-15-24-22(28)13-5-17-3-8-19(9-4-17)27(30)31/h3-14H,2,15-16H2,1H3,(H,24,28)/b13-5+ |
| InChIKey | SPPKMHDIWCABRV-WLRTZDKTSA-N |
| XLogP | 3.05 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|