C24H23ClF3N3O2 — CID 71816540
3-(5-chloro-1H-indol-3-yl)-N-[3-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]propyl]propanamide (PubChem CID 71816540) has the molecular formula C24H23ClF3N3O2 and a molecular weight of 477.91 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-N-[3-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]propyl]propanamide.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-N-[3-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]propyl]propanamide |
|---|---|
| PubChem CID | 71816540 |
| Molecular Formula | C24H23ClF3N3O2 |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-N-[3-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]propyl]propanamide |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)F)cc2c1CCCNC(=O)CCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H23ClF3N3O2/c1-14-18(20-12-17(33-24(26,27)28)6-8-22(20)31-14)3-2-10-29-23(32)9-4-15-13-30-21-7-5-16(25)11-19(15)21/h5-8,11-13,30-31H,2-4,9-10H2,1H3,(H,29,32) |
| InChIKey | OLLZIBKCXFHLLE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|