C17H21NO4 — CID 96523711
[(1S,2R)-2-methoxycyclopentyl] 2-(5-methoxy-1H-indol-3-yl)acetate (PubChem CID 96523711) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is [(1S,2R)-2-methoxycyclopentyl] 2-(5-methoxy-1H-indol-3-yl)acetate.
| Compound Name | [(1S,2R)-2-methoxycyclopentyl] 2-(5-methoxy-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 96523711 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(1S,2R)-2-methoxycyclopentyl] 2-(5-methoxy-1H-indol-3-yl)acetate |
| SMILES | COc1ccc2[nH]cc(CC(=O)O[C@H]3CCC[C@H]3OC)c2c1 |
| InChI | InChI=1S/C17H21NO4/c1-20-12-6-7-14-13(9-12)11(10-18-14)8-17(19)22-16-5-3-4-15(16)21-2/h6-7,9-10,15-16,18H,3-5,8H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | BZYMUBHAENWHCX-CVEARBPZSA-N |
| XLogP | 2.83 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |