C19H14N2O2 — CID 101442248
(Z)-3-hydroxy-1,3-bis(1H-indol-3-yl)prop-2-en-1-one (PubChem CID 101442248) has the molecular formula C19H14N2O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is (Z)-3-hydroxy-1,3-bis(1H-indol-3-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-hydroxy-1,3-bis(1H-indol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101442248 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (Z)-3-hydroxy-1,3-bis(1H-indol-3-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C(\O)c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H14N2O2/c22-18(14-10-20-16-7-3-1-5-12(14)16)9-19(23)15-11-21-17-8-4-2-6-13(15)17/h1-11,20-22H/b18-9- |
| InChIKey | UILMSDHJTJBXLP-NVMNQCDNSA-N |
| XLogP | 4.43 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|