C22H24ClN5O2 — CID 70244247
N-[2-[2-(1H-indole-3-carbonylamino)ethylamino]ethyl]indole-1-carboxamide;hydrochloride (PubChem CID 70244247) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is N-[2-[2-(1H-indole-3-carbonylamino)ethylamino]ethyl]indole-1-carboxamide;hydrochloride.
| Compound Name | N-[2-[2-(1H-indole-3-carbonylamino)ethylamino]ethyl]indole-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70244247 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[2-[2-(1H-indole-3-carbonylamino)ethylamino]ethyl]indole-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCNCCNC(=O)n1ccc2ccccc21)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H23N5O2.ClH/c28-21(18-15-26-19-7-3-2-6-17(18)19)24-12-10-23-11-13-25-22(29)27-14-9-16-5-1-4-8-20(16)27;/h1-9,14-15,23,26H,10-13H2,(H,24,28)(H,25,29);1H |
| InChIKey | JWTYVOZHWKUUKE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|