C12H15N3O3S — CID 84541178
N-[2-(methylsulfamoyl)ethyl]-1H-indole-3-carboxamide (PubChem CID 84541178) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[2-(methylsulfamoyl)ethyl]-1H-indole-3-carboxamide.
| Compound Name | N-[2-(methylsulfamoyl)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 84541178 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[2-(methylsulfamoyl)ethyl]-1H-indole-3-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H15N3O3S/c1-13-19(17,18)7-6-14-12(16)10-8-15-11-5-3-2-4-9(10)11/h2-5,8,13,15H,6-7H2,1H3,(H,14,16) |
| InChIKey | AIGDCMXHGLDKFV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |