C13H14NO5P — CID 6477471
(Z)-2-dimethoxyphosphoryl-3-(1H-indol-3-yl)prop-2-enoic acid (PubChem CID 6477471) has the molecular formula C13H14NO5P and a molecular weight of 295.23 g/mol. Its IUPAC name is (Z)-2-dimethoxyphosphoryl-3-(1H-indol-3-yl)prop-2-enoic acid.
| Compound Name | (Z)-2-dimethoxyphosphoryl-3-(1H-indol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6477471 |
| Molecular Formula | C13H14NO5P |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (Z)-2-dimethoxyphosphoryl-3-(1H-indol-3-yl)prop-2-enoic acid |
| SMILES | COP(=O)(OC)/C(=C\c1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H14NO5P/c1-18-20(17,19-2)12(13(15)16)7-9-8-14-11-6-4-3-5-10(9)11/h3-8,14H,1-2H3,(H,15,16)/b12-7- |
| InChIKey | RSZCOKNQGBVIPH-GHXNOFRVSA-N |
| XLogP | 3.08 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|