C33H40N2O13S — CID 146297667
[(2R,3S,4S,5R,6S)-6-[[(E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate (PubChem CID 146297667) has the molecular formula C33H40N2O13S and a molecular weight of 704.75 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[(E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[(E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 146297667 |
| Molecular Formula | C33H40N2O13S |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](ONC(=O)/C=C/c2cccc(S(=O)(=O)Nc3ccccc3)c2)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C33H40N2O13S/c1-5-26(37)43-20-24-30(45-27(38)6-2)31(46-28(39)7-3)32(47-29(40)8-4)33(44-24)48-34-25(36)18-17-21-13-12-16-23(19-21)49(41,42)35-22-14-10-9-11-15-22/h9-19,24,30-33,35H,5-8,20H2,1-4H3,(H,34,36)/b18-17+/t24-,30+,31+,32-,33+/m1/s1 |
| InChIKey | LIGDFCCYZQPRKJ-XKCVEASDSA-N |
| XLogP | 3.19 |
| TPSA | 198.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|