C36H46N2O12 — CID 146297653
[(2R,3S,4S,5R,6S)-6-[[4-[[(2S)-3-methyl-2-phenylbutanoyl]amino]benzoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate (PubChem CID 146297653) has the molecular formula C36H46N2O12 and a molecular weight of 698.77 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[4-[[(2S)-3-methyl-2-phenylbutanoyl]amino]benzoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[4-[[(2S)-3-methyl-2-phenylbutanoyl]amino]benzoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 146297653 |
| Molecular Formula | C36H46N2O12 |
| Molecular Weight | 698.77 g/mol |
| Exact Mass | 698.31 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[4-[[(2S)-3-methyl-2-phenylbutanoyl]amino]benzoyl]amino]oxy-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](ONC(=O)c2ccc(NC(=O)[C@H](c3ccccc3)C(C)C)cc2)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C36H46N2O12/c1-7-26(39)45-20-25-31(47-27(40)8-2)32(48-28(41)9-3)33(49-29(42)10-4)36(46-25)50-38-34(43)23-16-18-24(19-17-23)37-35(44)30(21(5)6)22-14-12-11-13-15-22/h11-19,21,25,30-33,36H,7-10,20H2,1-6H3,(H,37,44)(H,38,43)/t25-,30+,31+,32+,33-,36+/m1/s1 |
| InChIKey | HXXYXRFYMUZYHN-CADBFNHISA-N |
| XLogP | 4.37 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|