C64H115NO9 — CID 138735828
[2-[3-(dimethylamino)propanoyloxymethyl]-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate (PubChem CID 138735828) has the molecular formula C64H115NO9 and a molecular weight of 1042.62 g/mol. Its IUPAC name is [2-[3-(dimethylamino)propanoyloxymethyl]-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [2-[3-(dimethylamino)propanoyloxymethyl]-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 138735828 |
| Molecular Formula | C64H115NO9 |
| Molecular Weight | 1042.62 g/mol |
| Exact Mass | 1041.86 |
| IUPAC Name | [2-[3-(dimethylamino)propanoyloxymethyl]-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC1OC(COC(=O)CCN(C)C)C(OC(=O)CCCCCCC/C=C\CCCCCCCC)C1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C64H115NO9/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-59(67)72-62-57(56-70-58(66)54-55-65(4)5)71-64(74-61(69)53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3)63(62)73-60(68)52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2/h27-32,57,62-64H,6-26,33-56H2,1-5H3/b30-27-,31-28-,32-29- |
| InChIKey | FUOJTOMDMALVDV-PGEUSFDPSA-N |
| XLogP | 17.69 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.62 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|