C51H96N2O7 — CID 167690388
[(2S,5S)-5-[3-(dimethylamino)propanoyloxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate;bis((9Z,12Z)-octadeca-9,12-dien-1-ol) (PubChem CID 167690388) has the molecular formula C51H96N2O7 and a molecular weight of 849.34 g/mol. Its IUPAC name is [(2S,5S)-5-[3-(dimethylamino)propanoyloxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate;bis((9Z,12Z)-octadeca-9,12-dien-1-ol).
| Compound Name | [(2S,5S)-5-[3-(dimethylamino)propanoyloxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate;bis((9Z,12Z)-octadeca-9,12-dien-1-ol) |
|---|---|
| PubChem CID | 167690388 |
| Molecular Formula | C51H96N2O7 |
| Molecular Weight | 849.34 g/mol |
| Exact Mass | 848.72 |
| IUPAC Name | [(2S,5S)-5-[3-(dimethylamino)propanoyloxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate;bis((9Z,12Z)-octadeca-9,12-dien-1-ol) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO.CCCCC/C=C\C/C=C\CCCCCCCCO.CN(C)CCC(=O)OC[C@@H]1CC[C@H](OC(=O)CCN(C)C)O1 |
| InChI | InChI=1S/2C18H34O.C15H28N2O5/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-16(2)9-7-13(18)20-11-12-5-6-15(21-12)22-14(19)8-10-17(3)4/h2*6-7,9-10,19H,2-5,8,11-18H2,1H3;12,15H,5-11H2,1-4H3/b2*7-6-,10-9-;/t;;12-,15-/m..0/s1 |
| InChIKey | WVPVADXWXYUIOJ-DNOAVKLSSA-N |
| XLogP | 12.07 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.34 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|