C66H113NO6 — CID 165379605
[(2R,4S,5R)-3,5-bis[(10Z,13Z,16Z)-nonadeca-10,13,16-trienoxy]-4-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate (PubChem CID 165379605) has the molecular formula C66H113NO6 and a molecular weight of 1016.63 g/mol. Its IUPAC name is [(2R,4S,5R)-3,5-bis[(10Z,13Z,16Z)-nonadeca-10,13,16-trienoxy]-4-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate.
| Compound Name | [(2R,4S,5R)-3,5-bis[(10Z,13Z,16Z)-nonadeca-10,13,16-trienoxy]-4-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 165379605 |
| Molecular Formula | C66H113NO6 |
| Molecular Weight | 1016.63 g/mol |
| Exact Mass | 1015.86 |
| IUPAC Name | [(2R,4S,5R)-3,5-bis[(10Z,13Z,16Z)-nonadeca-10,13,16-trienoxy]-4-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCOC1[C@@H](COC(=O)CCN(C)C)O[C@@H](OCCCCCCCCC/C=C\C/C=C\C/C=C\CC)[C@H]1OCCCCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C66H113NO6/c1-6-9-12-15-18-21-24-27-30-33-36-38-41-44-47-50-53-58-69-64-62(61-72-63(68)56-57-67(4)5)73-66(71-60-55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)65(64)70-59-54-51-48-45-42-39-35-32-29-26-23-20-17-14-11-8-3/h9-14,18-23,27-32,62,64-66H,6-8,15-17,24-26,33-61H2,1-5H3/b12-9-,13-10-,14-11-,21-18-,22-19-,23-20-,30-27-,31-28-,32-29-/t62-,64?,65+,66-/m1/s1 |
| InChIKey | QUANYPOJRJHONP-MEZXZNCPSA-N |
| XLogP | 18.54 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.63 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|