C63H113NO6 — CID 165379680
[(2R,4S,5R)-3,4,5-tris[(9Z,12Z)-octadeca-9,12-dienoxy]oxolan-2-yl]methyl 2-(dimethylamino)acetate (PubChem CID 165379680) has the molecular formula C63H113NO6 and a molecular weight of 980.60 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4,5-tris[(9Z,12Z)-octadeca-9,12-dienoxy]oxolan-2-yl]methyl 2-(dimethylamino)acetate.
| Compound Name | [(2R,4S,5R)-3,4,5-tris[(9Z,12Z)-octadeca-9,12-dienoxy]oxolan-2-yl]methyl 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 165379680 |
| Molecular Formula | C63H113NO6 |
| Molecular Weight | 980.60 g/mol |
| Exact Mass | 979.86 |
| IUPAC Name | [(2R,4S,5R)-3,4,5-tris[(9Z,12Z)-octadeca-9,12-dienoxy]oxolan-2-yl]methyl 2-(dimethylamino)acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC1[C@@H](COC(=O)CN(C)C)O[C@@H](OCCCCCCCC/C=C\C/C=C\CCCCC)[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C63H113NO6/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-54-66-61-59(58-69-60(65)57-64(4)5)70-63(68-56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3)62(61)67-55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2/h18-23,27-32,59,61-63H,6-17,24-26,33-58H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29-/t59-,61?,62+,63-/m1/s1 |
| InChIKey | CCVOQWLZXGYIIJ-LXVQCJGXSA-N |
| XLogP | 18.04 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.60 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|