C77H147NO12 — CID 165379530
3-pentyloctyl 9-[(2R,4S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-4,5-bis[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate (PubChem CID 165379530) has the molecular formula C77H147NO12 and a molecular weight of 1279.02 g/mol. Its IUPAC name is 3-pentyloctyl 9-[(2R,4S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-4,5-bis[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate.
| Compound Name | 3-pentyloctyl 9-[(2R,4S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-4,5-bis[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate |
|---|---|
| PubChem CID | 165379530 |
| Molecular Formula | C77H147NO12 |
| Molecular Weight | 1279.02 g/mol |
| Exact Mass | 1278.09 |
| IUPAC Name | 3-pentyloctyl 9-[(2R,4S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-4,5-bis[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCOC1[C@@H](COC(=O)CCCN(C)C)O[C@@H](OCCCCCCCCC(=O)OCCC(CCCCC)CCCCC)[C@H]1OCCCCCCCCC(=O)OCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C77H147NO12/c1-9-15-33-46-67(47-34-16-10-2)56-63-83-71(79)52-39-27-21-24-30-42-60-86-75-70(66-89-74(82)55-45-59-78(7)8)90-77(88-62-44-32-26-23-29-41-54-73(81)85-65-58-69(50-37-19-13-5)51-38-20-14-6)76(75)87-61-43-31-25-22-28-40-53-72(80)84-64-57-68(48-35-17-11-3)49-36-18-12-4/h67-70,75-77H,9-66H2,1-8H3/t70-,75?,76+,77-/m1/s1 |
| InChIKey | IFYCVUPHQYQQOG-CIWSMLLFSA-N |
| XLogP | 20.71 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 69 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1279.02 |
| LogP ≤ 5 | 20.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|