C27H53NO5 — CID 165379758
[(2S,5R)-5-(9-octoxynonoxy)oxolan-2-yl]methyl 3-(dimethylamino)propanoate (PubChem CID 165379758) has the molecular formula C27H53NO5 and a molecular weight of 471.72 g/mol. Its IUPAC name is [(2S,5R)-5-(9-octoxynonoxy)oxolan-2-yl]methyl 3-(dimethylamino)propanoate.
| Compound Name | [(2S,5R)-5-(9-octoxynonoxy)oxolan-2-yl]methyl 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 165379758 |
| Molecular Formula | C27H53NO5 |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.39 |
| IUPAC Name | [(2S,5R)-5-(9-octoxynonoxy)oxolan-2-yl]methyl 3-(dimethylamino)propanoate |
| SMILES | CCCCCCCCOCCCCCCCCCO[C@H]1CC[C@@H](COC(=O)CCN(C)C)O1 |
| InChI | InChI=1S/C27H53NO5/c1-4-5-6-7-11-14-21-30-22-15-12-9-8-10-13-16-23-31-27-18-17-25(33-27)24-32-26(29)19-20-28(2)3/h25,27H,4-24H2,1-3H3/t25-,27+/m0/s1 |
| InChIKey | URDFHUOVWNCCKL-AHKZPQOWSA-N |
| XLogP | 6.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|