C58H115NO8 — CID 177166555
[5-[3-(dimethylamino)propoxy]oxolan-2-yl]methyl 2-hexyldecanoate;bis(2-hexyldecanoic acid) (PubChem CID 177166555) has the molecular formula C58H115NO8 and a molecular weight of 954.56 g/mol. Its IUPAC name is [5-[3-(dimethylamino)propoxy]oxolan-2-yl]methyl 2-hexyldecanoate;bis(2-hexyldecanoic acid).
| Compound Name | [5-[3-(dimethylamino)propoxy]oxolan-2-yl]methyl 2-hexyldecanoate;bis(2-hexyldecanoic acid) |
|---|---|
| PubChem CID | 177166555 |
| Molecular Formula | C58H115NO8 |
| Molecular Weight | 954.56 g/mol |
| Exact Mass | 953.86 |
| IUPAC Name | [5-[3-(dimethylamino)propoxy]oxolan-2-yl]methyl 2-hexyldecanoate;bis(2-hexyldecanoic acid) |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)O.CCCCCCCCC(CCCCCC)C(=O)O.CCCCCCCCC(CCCCCC)C(=O)OCC1CCC(OCCCN(C)C)O1 |
| InChI | InChI=1S/C26H51NO4.2C16H32O2/c1-5-7-9-11-12-14-17-23(16-13-10-8-6-2)26(28)30-22-24-18-19-25(31-24)29-21-15-20-27(3)4;2*1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h23-25H,5-22H2,1-4H3;2*15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | YPIURDCCLKITKI-UHFFFAOYSA-N |
| XLogP | 17.16 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.56 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|