C38H73NO9 — CID 153365367
[5-[4-(dimethylamino)butanoyloxymethyl]oxolan-2-yl] 7-methyloctanoate;bis(7-methyloctanoic acid) (PubChem CID 153365367) has the molecular formula C38H73NO9 and a molecular weight of 688.00 g/mol. Its IUPAC name is [5-[4-(dimethylamino)butanoyloxymethyl]oxolan-2-yl] 7-methyloctanoate;bis(7-methyloctanoic acid).
| Compound Name | [5-[4-(dimethylamino)butanoyloxymethyl]oxolan-2-yl] 7-methyloctanoate;bis(7-methyloctanoic acid) |
|---|---|
| PubChem CID | 153365367 |
| Molecular Formula | C38H73NO9 |
| Molecular Weight | 688.00 g/mol |
| Exact Mass | 687.53 |
| IUPAC Name | [5-[4-(dimethylamino)butanoyloxymethyl]oxolan-2-yl] 7-methyloctanoate;bis(7-methyloctanoic acid) |
| SMILES | CC(C)CCCCCC(=O)O.CC(C)CCCCCC(=O)O.CC(C)CCCCCC(=O)OC1CCC(COC(=O)CCCN(C)C)O1 |
| InChI | InChI=1S/C20H37NO5.2C9H18O2/c1-16(2)9-6-5-7-10-19(23)26-20-13-12-17(25-20)15-24-18(22)11-8-14-21(3)4;2*1-8(2)6-4-3-5-7-9(10)11/h16-17,20H,5-15H2,1-4H3;2*8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | OFPXOZSCMICFJZ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.00 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|