C47H85NO8 — CID 165379660
[(2R,3S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-5-hydroxy-4-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate (PubChem CID 165379660) has the molecular formula C47H85NO8 and a molecular weight of 792.20 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-5-hydroxy-4-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-5-hydroxy-4-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 165379660 |
| Molecular Formula | C47H85NO8 |
| Molecular Weight | 792.20 g/mol |
| Exact Mass | 791.63 |
| IUPAC Name | [(2R,3S,5R)-2-[4-(dimethylamino)butanoyloxymethyl]-5-hydroxy-4-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC1[C@H](O)O[C@H](COC(=O)CCCN(C)C)[C@@H]1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C47H85NO8/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-43(50)55-45-41(40-53-42(49)38-35-39-48(3)4)54-47(52)46(45)56-44(51)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,41,45-47,52H,5-18,23-40H2,1-4H3/b21-19-,22-20-/t41-,45+,46?,47-/m1/s1 |
| InChIKey | HTEUHMBXJCNGLO-JRAUCABHSA-N |
| XLogP | 11.49 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.20 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|