C84H152O12 — CID 177436195
[(2R,3S,4R,5R,6S)-6-[2,2-bis[[(Z)-octadec-9-enoyl]oxymethyl]butoxy]-4,5-dihydroxy-3-[(Z)-octadec-9-enoyl]oxyoxan-2-yl]methyl (Z)-octadec-9-enoate (PubChem CID 177436195) has the molecular formula C84H152O12 and a molecular weight of 1354.13 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[2,2-bis[[(Z)-octadec-9-enoyl]oxymethyl]butoxy]-4,5-dihydroxy-3-[(Z)-octadec-9-enoyl]oxyoxan-2-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[2,2-bis[[(Z)-octadec-9-enoyl]oxymethyl]butoxy]-4,5-dihydroxy-3-[(Z)-octadec-9-enoyl]oxyoxan-2-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 177436195 |
| Molecular Formula | C84H152O12 |
| Molecular Weight | 1354.13 g/mol |
| Exact Mass | 1353.13 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[2,2-bis[[(Z)-octadec-9-enoyl]oxymethyl]butoxy]-4,5-dihydroxy-3-[(Z)-octadec-9-enoyl]oxyoxan-2-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]1O[C@H](OCC(CC)(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC)[C@H](O)[C@@H](O)[C@@H]1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C84H152O12/c1-6-11-15-19-23-27-31-35-39-43-47-51-55-59-63-67-76(85)91-71-75-82(96-79(88)70-66-62-58-54-50-46-42-38-34-30-26-22-18-14-9-4)80(89)81(90)83(95-75)94-74-84(10-5,72-92-77(86)68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-7-2)73-93-78(87)69-65-61-57-53-49-45-41-37-33-29-25-21-17-13-8-3/h35-42,75,80-83,89-90H,6-34,43-74H2,1-5H3/b39-35-,40-36-,41-37-,42-38-/t75-,80-,81-,82-,83+/m1/s1 |
| InChIKey | ITBLUCJQXYJTMX-PTWIYSTJSA-N |
| XLogP | 23.54 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 71 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1354.13 |
| LogP ≤ 5 | 23.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|