C56H106O13 — CID 71546858
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(4-nonyltridecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 4-nonyltridecanoate (PubChem CID 71546858) has the molecular formula C56H106O13 and a molecular weight of 987.45 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(4-nonyltridecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 4-nonyltridecanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(4-nonyltridecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 4-nonyltridecanoate |
|---|---|
| PubChem CID | 71546858 |
| Molecular Formula | C56H106O13 |
| Molecular Weight | 987.45 g/mol |
| Exact Mass | 986.76 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(4-nonyltridecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 4-nonyltridecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)CCC(=O)OC[C@H]1O[C@H](O[C@H]2O[C@H](COC(=O)CCC(CCCCCCCCC)CCCCCCCCC)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C56H106O13/c1-5-9-13-17-21-25-29-33-43(34-30-26-22-18-14-10-6-2)37-39-47(57)65-41-45-49(59)51(61)53(63)55(67-45)69-56-54(64)52(62)50(60)46(68-56)42-66-48(58)40-38-44(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h43-46,49-56,59-64H,5-42H2,1-4H3/t45-,46-,49-,50-,51+,52+,53-,54-,55-,56-/m1/s1 |
| InChIKey | ATPGTAUJSITPSF-LXOQPCSCSA-N |
| XLogP | 11.06 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 69 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.45 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|