C11H18O8 — CID 57042888
[(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2,2-dimethoxyoxolan-3-yl] 3-oxobutanoate (PubChem CID 57042888) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is [(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2,2-dimethoxyoxolan-3-yl] 3-oxobutanoate.
| Compound Name | [(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2,2-dimethoxyoxolan-3-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 57042888 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | [(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2,2-dimethoxyoxolan-3-yl] 3-oxobutanoate |
| SMILES | COC1(OC)O[C@H](CO)[C@@H](O)[C@H]1OC(=O)CC(C)=O |
| InChI | InChI=1S/C11H18O8/c1-6(13)4-8(14)18-10-9(15)7(5-12)19-11(10,16-2)17-3/h7,9-10,12,15H,4-5H2,1-3H3/t7-,9-,10-/m1/s1 |
| InChIKey | GHALLIKBNQGETL-SZEHBUNVSA-N |
| XLogP | -1.42 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|