C8H14N2O6 — CID 156617179
N-[(3R,4R,5S,6S)-5-aminooxy-4-hydroxy-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-6-yl]acetamide (PubChem CID 156617179) has the molecular formula C8H14N2O6 and a molecular weight of 234.21 g/mol. Its IUPAC name is N-[(3R,4R,5S,6S)-5-aminooxy-4-hydroxy-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-6-yl]acetamide.
| Compound Name | N-[(3R,4R,5S,6S)-5-aminooxy-4-hydroxy-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-6-yl]acetamide |
|---|---|
| PubChem CID | 156617179 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-[(3R,4R,5S,6S)-5-aminooxy-4-hydroxy-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-6-yl]acetamide |
| SMILES | CC(=O)N[C@@]12OC1O[C@H](CO)[C@@H](O)[C@@H]2ON |
| InChI | InChI=1S/C8H14N2O6/c1-3(12)10-8-6(16-9)5(13)4(2-11)14-7(8)15-8/h4-7,11,13H,2,9H2,1H3,(H,10,12)/t4-,5-,6+,7?,8+/m1/s1 |
| InChIKey | DZKJLDSEKWNEPG-PSJDMVPZSA-N |
| XLogP | -2.81 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|