C11H18O11 — CID 174841620
bis[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] carbonate (PubChem CID 174841620) has the molecular formula C11H18O11 and a molecular weight of 326.25 g/mol. Its IUPAC name is bis[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] carbonate.
| Compound Name | bis[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] carbonate |
|---|---|
| PubChem CID | 174841620 |
| Molecular Formula | C11H18O11 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | bis[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] carbonate |
| SMILES | O=C(OC1O[C@H](CO)[C@@H](O)[C@H]1O)OC1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H18O11/c12-1-3-5(14)7(16)9(19-3)21-11(18)22-10-8(17)6(15)4(2-13)20-10/h3-10,12-17H,1-2H2/t3-,4-,5-,6-,7-,8-,9?,10?/m1/s1 |
| InChIKey | JWMXBUAQGHMQKZ-KUFNSSOESA-N |
| XLogP | -3.98 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |