C10H18O9 — CID 70023537
2-methoxyethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate (PubChem CID 70023537) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-methoxyethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate.
| Compound Name | 2-methoxyethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate |
|---|---|
| PubChem CID | 70023537 |
| Molecular Formula | C10H18O9 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-methoxyethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate |
| SMILES | COCCOC(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O9/c1-16-2-3-17-10(15)19-9-8(14)7(13)6(12)5(4-11)18-9/h5-9,11-14H,2-4H2,1H3/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | WXKXQLWOMPFHNF-ZEBDFXRSSA-N |
| XLogP | -2.41 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|