C15H24O14 — CID 22859874
bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate (PubChem CID 22859874) has the molecular formula C15H24O14 and a molecular weight of 428.34 g/mol. Its IUPAC name is bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate.
| Compound Name | bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate |
|---|---|
| PubChem CID | 22859874 |
| Molecular Formula | C15H24O14 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate |
| SMILES | O=C(CC(=O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24O14/c16-2-4-8(20)10(22)12(24)14(26-4)28-6(18)1-7(19)29-15-13(25)11(23)9(21)5(3-17)27-15/h4-5,8-17,20-25H,1-3H2/t4-,5-,8-,9-,10+,11+,12-,13-,14?,15?/m1/s1 |
| InChIKey | MSTAJAQGTVDZEV-NQVLJCSASA-N |
| XLogP | -5.94 |
| TPSA | 232.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | -5.94 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|