C8H13ClO7 — CID 163587243
[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-chloroacetate (PubChem CID 163587243) has the molecular formula C8H13ClO7 and a molecular weight of 256.64 g/mol. Its IUPAC name is [(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-chloroacetate.
| Compound Name | [(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 163587243 |
| Molecular Formula | C8H13ClO7 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | [(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@@H]1OC(CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C8H13ClO7/c9-1-4(11)16-8-7(14)6(13)5(12)3(2-10)15-8/h3,5-8,10,12-14H,1-2H2/t3?,5-,6?,7?,8+/m1/s1 |
| InChIKey | GMMWEZBZANPYOC-RGELLDLNSA-N |
| XLogP | -2.43 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|