C11H20O8 — CID 22857916
butyl [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate (PubChem CID 22857916) has the molecular formula C11H20O8 and a molecular weight of 280.27 g/mol. Its IUPAC name is butyl [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate.
| Compound Name | butyl [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate |
|---|---|
| PubChem CID | 22857916 |
| Molecular Formula | C11H20O8 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | butyl [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate |
| SMILES | CCCCOC(=O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20O8/c1-2-3-4-17-11(16)19-10-9(15)8(14)7(13)6(5-12)18-10/h6-10,12-15H,2-5H2,1H3/t6-,7-,8+,9+,10?/m1/s1 |
| InChIKey | AHTHUCPCJYCVQG-NTUKYRGVSA-N |
| XLogP | -1.26 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|