C14H27NO7 — CID 67372598
[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-heptan-2-ylcarbamate (PubChem CID 67372598) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-heptan-2-ylcarbamate.
| Compound Name | [(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-heptan-2-ylcarbamate |
|---|---|
| PubChem CID | 67372598 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-heptan-2-ylcarbamate |
| SMILES | CCCCCC(C)NC(=O)O[C@@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H27NO7/c1-3-4-5-6-8(2)15-14(20)22-13-12(19)11(18)10(17)9(7-16)21-13/h8-13,16-19H,3-7H2,1-2H3,(H,15,20)/t8?,9-,10-,11+,12-,13-/m0/s1 |
| InChIKey | ZYBVXWXTWHFWCC-OBRSCCDWSA-N |
| XLogP | -0.52 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|