C9H13Cl3O8 — CID 54430474
2,2,2-trichloroethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate (PubChem CID 54430474) has the molecular formula C9H13Cl3O8 and a molecular weight of 355.55 g/mol. Its IUPAC name is 2,2,2-trichloroethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate.
| Compound Name | 2,2,2-trichloroethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate |
|---|---|
| PubChem CID | 54430474 |
| Molecular Formula | C9H13Cl3O8 |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2,2,2-trichloroethyl [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] carbonate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H13Cl3O8/c10-9(11,12)2-18-8(17)20-7-6(16)5(15)4(14)3(1-13)19-7/h3-7,13-16H,1-2H2/t3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | WHCMQTYUNOMFDO-ZFYZTMLRSA-N |
| XLogP | -0.69 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|