C8H11Br3O7 — CID 174903349
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-tribromoacetate (PubChem CID 174903349) has the molecular formula C8H11Br3O7 and a molecular weight of 458.88 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-tribromoacetate.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-tribromoacetate |
|---|---|
| PubChem CID | 174903349 |
| Molecular Formula | C8H11Br3O7 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 455.81 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-tribromoacetate |
| SMILES | O=C(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(Br)(Br)Br |
| InChI | InChI=1S/C8H11Br3O7/c9-8(10,11)7(16)18-6-5(15)4(14)3(13)2(1-12)17-6/h2-6,12-15H,1H2/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | IZZYFRLVJUEQIX-GASJEMHNSA-N |
| XLogP | -0.83 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|