C8H12Cl3NO7 — CID 87788965
2,2,2-trichloro-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide (PubChem CID 87788965) has the molecular formula C8H12Cl3NO7 and a molecular weight of 340.54 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide.
| Compound Name | 2,2,2-trichloro-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 87788965 |
| Molecular Formula | C8H12Cl3NO7 |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 2,2,2-trichloro-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide |
| SMILES | O=C(NO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3NO7/c9-8(10,11)7(17)12-19-6-5(16)4(15)3(14)2(1-13)18-6/h2-6,13-16H,1H2,(H,12,17)/t2-,3+,4+,5-,6-/m1/s1 |
| InChIKey | WOEJNNAGSQTQEN-FPRJBGLDSA-N |
| XLogP | -1.80 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|